CAS 2089649-39-6

2,2-Dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone

Description:

2,2-Dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a trifluoromethyl group and a dibromoethanone moiety. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on its specific molecular interactions. The presence of bromine atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's unique structure may impart specific electronic properties, affecting its behavior in chemical reactions and interactions with biological systems. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,2-Dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone represents a versatile compound with potential applications in pharmaceuticals and agrochemicals.

Formula: C₈H₄Br₂F₃NO

InChI: InChI=1S/C8H4Br2F3NO/c9-7(10)6(15)4-1-2-5(14-3-4)8(11,12)13/h1-3,7H

InChI key: InChIKey=QGPDTRYWPNCTHZ-UHFFFAOYSA-N

SMILES: C(C(Br)Br)(=O)C=1C=CC(C(F)(F)F)=NC1

Synonyms:

• Ethanone, 2,2-dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]-
• 2,2-Dibromo-1-[6-(trifluoromethyl)-3-pyridinyl]ethanone

2,2-DIBROMO-1-(6-(TRIFLUOROMETHYL)PYRIDIN-3-YL)ETHANONE

CAS: 2089649-39-6

Formula: C₈H₄Br₂F₃NO

Purity: 95.0%

Molecular weight: 346.929

Ref: 10-F535556