CAS 2089650-00-8

4-Piperidinamine, 1,3,3-trimethyl-, hydrochloride (1:1)

Description:

4-Piperidinamine, 1,3,3-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of three methyl groups at the 1 and 3 positions of the piperidine ring contributes to its steric and electronic properties, influencing its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. This compound may exhibit basic properties due to the amine functional group, allowing it to participate in protonation reactions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities, which can be reactive. Overall, 4-Piperidinamine, 1,3,3-trimethyl-, hydrochloride is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₈H₁₈N₂·ClH

InChI: InChI=1S/C8H18N2.ClH/c1-8(2)6-10(3)5-4-7(8)9;/h7H,4-6,9H2,1-3H3;1H

InChI key: InChIKey=ZSMVADLNQVACGF-UHFFFAOYSA-N

SMILES: CC1(C)C(N)CCN(C)C1.Cl

Synonyms:

• 4-Piperidinamine, 1,3,3-trimethyl-, hydrochloride (1:1)

1,3,3-TRIMETHYLPIPERIDIN-4-AMINE HYDROCHLORIDE

CAS: 2089650-00-8

Formula: C₈H₁₉ClN₂

Purity: 95.0%

Molecular weight: 178.7

Ref: 10-F500683