CymitQuimica logo

CAS 2089650-62-2

:

Cyclobutanol, 1-(2-pyrrolidinyl)-, hydrochloride (1:1)

Description:
Cyclobutanol, 1-(2-pyrrolidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a pyrrolidine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the pyrrolidine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit interesting biological activities. The hydrochloride form indicates that the compound is a salt, which can influence its stability, solubility, and bioavailability. As with many organic compounds, the specific properties such as melting point, boiling point, and reactivity can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper safety protocols are followed.
Formula:C8H15NO·ClH
InChI:InChI=1S/C8H15NO.ClH/c10-8(4-2-5-8)7-3-1-6-9-7;/h7,9-10H,1-6H2;1H
InChI key:InChIKey=QSGDFXZMHMXFGR-UHFFFAOYSA-N
SMILES:OC1(CCC1)C2CCCN2.Cl
Synonyms:
  • Cyclobutanol, 1-(2-pyrrolidinyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.