
CAS 2089651-36-3
:3-Amino-6-[4-[[2-[4-[2-(dimethylamino)ethyl]-1-piperidinyl]ethyl]sulfonyl]phenyl]-N-phenyl-2-pyrazinecarboxamide
Description:
3-Amino-6-[4-[[2-[4-[2-(dimethylamino)ethyl]-1-piperidinyl]ethyl]sulfonyl]phenyl]-N-phenyl-2-pyrazinecarboxamide is a complex organic compound characterized by its multi-functional structure, which includes an amino group, a sulfonyl group, and a pyrazinecarboxamide moiety. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amino and carboxamide groups. The dimethylamino and piperidinyl substituents suggest that it may have basic properties, which could influence its interaction with biological targets. The presence of multiple aromatic rings may contribute to its stability and lipophilicity, potentially affecting its pharmacokinetic profile if it is intended for medicinal use. Additionally, the compound's structure indicates potential for various chemical reactions, making it a candidate for further synthetic modifications or applications in drug development. However, specific physical and chemical properties would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C28H36N6O3S
InChI:InChI=1S/C28H36N6O3S/c1-33(2)15-12-21-13-16-34(17-14-21)18-19-38(36,37)24-10-8-22(9-11-24)25-20-30-27(29)26(32-25)28(35)31-23-6-4-3-5-7-23/h3-11,20-21H,12-19H2,1-2H3,(H2,29,30)(H,31,35)
InChI key:InChIKey=NKWAWWMZIXYIGE-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2N=C(C=NC2N)C3=CC=C(S(CCN4CCC(CCN(C)C)CC4)(=O)=O)C=C3
Synonyms:- 3-Amino-6-[4-[[2-[4-[2-(dimethylamino)ethyl]-1-piperidinyl]ethyl]sulfonyl]phenyl]-N-phenyl-2-pyrazinecarboxamide
- 2-Pyrazinecarboxamide, 3-amino-6-[4-[[2-[4-[2-(dimethylamino)ethyl]-1-piperidinyl]ethyl]sulfonyl]phenyl]-N-phenyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery