CymitQuimica logo

CAS 2089651-71-6

:

6-(Bromomethyl)-8-chloroquinoline

Description:
6-(Bromomethyl)-8-chloroquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a bromomethyl group at the 6-position and a chlorine atom at the 8-position of the quinoline ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of halogen substituents often enhances the compound's biological activity and can influence its pharmacokinetic properties. Typically, compounds like this may exhibit antimicrobial, antiviral, or anticancer properties, making them of interest in drug development. The molecular structure allows for various synthetic modifications, which can lead to derivatives with improved efficacy or selectivity. Additionally, the compound's solubility, stability, and reactivity can be influenced by the electronic effects of the halogen atoms. As with many halogenated organic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C10H7BrClN
InChI:InChI=1S/C10H7BrClN/c11-6-7-4-8-2-1-3-13-10(8)9(12)5-7/h1-5H,6H2
InChI key:InChIKey=TZAPBAHIXBZDAF-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(CBr)C1)C=CC=N2
Synonyms:
  • Quinoline, 6-(bromomethyl)-8-chloro-
  • 6-(Bromomethyl)-8-chloroquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.