CAS 20898-21-9

(H-Cys-Ala-OH)2 (Disulfide bond)

Description:

The chemical substance with the name "(H-Cys-Ala-OH)2 (Disulfide bond)" and CAS number 20898-21-9 is a dipeptide formed from the amino acids cysteine (Cys) and alanine (Ala), linked by a disulfide bond. This compound features two cysteine residues that can form a covalent bond between their thiol (-SH) groups, resulting in a disulfide linkage, which is crucial for stabilizing the three-dimensional structure of proteins. The presence of the disulfide bond imparts unique properties, such as increased stability and resistance to denaturation under certain conditions. The molecule is typically involved in various biological processes, including protein folding and function. Additionally, the amino acid sequence and the presence of functional groups contribute to its reactivity and potential applications in biochemistry and pharmaceuticals. Overall, this compound exemplifies the importance of disulfide bonds in maintaining the structural integrity of peptides and proteins in biological systems.

Formula: C₁₂H₂₂N₄O₆S₂

InChI: InChI=1/C12H22N4O6S2/c1-5(11(19)20)15-9(17)7(13)3-23-24-4-8(14)10(18)16-6(2)12(21)22/h5-8H,3-4,13-14H2,1-2H3,(H,15,17)(H,16,18)(H,19,20)(H,21,22)

SMILES: CC(C(=O)O)N=C(C(CSSCC(C(=NC(C)C(=O)O)O)N)N)O

Synonyms:

• N-(2-Amino-3-((2-amino-3-((1-carboxyethyl)amino)-3-oxopropyl)dithio)propanoyl)alanine
• Nsc 333710
• 2,2'-{Disulfanediylbis[(2-Amino-1-Oxopropane-3,1-Diyl)Imino]}Dipropanoic Acid (Non-Preferred Name)
• (H-Cys-Ala-Oh)2

(H-Cys-Ala-OH)2 (Disulfide bond)

CAS: 20898-21-9

Please enquire for more information about (H-Cys-Ala-OH)2 (Disulfide bond) including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₂₂N₄O₆S₂

Purity: Min. 95%

Molecular weight: 382.46 g/mol

Ref: 3D-FC108016