CAS 20898-85-5

(5-nitrothiophen-2-yl)methanol

Description:

(5-Nitrothiophen-2-yl)methanol is an organic compound characterized by the presence of a thiophene ring substituted with a nitro group and a hydroxymethyl group. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, contributes to the compound's unique electronic properties and potential reactivity. The nitro group, known for its electron-withdrawing characteristics, can influence the compound's reactivity and stability, making it a candidate for various chemical reactions, including nucleophilic substitutions. The hydroxymethyl group (-CH2OH) adds a functional site that can participate in further chemical transformations, such as oxidation or esterification. This compound may exhibit interesting biological activities due to the presence of both the nitro and thiophene functionalities, which are often associated with pharmacological properties. Additionally, its solubility and stability in different solvents can vary, impacting its applications in synthesis and research. Overall, (5-nitrothiophen-2-yl)methanol is a versatile compound with potential uses in organic synthesis and medicinal chemistry.

Formula: C₅H₅NO₃S

InChI: InChI=1/C5H5NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-2,7H,3H2

SMILES: c1cc(N(=O)=O)sc1CO

(5-Nitrothiophen-2-yl)methanol

CAS: 20898-85-5

Formula: C₅H₅NO₃S

Purity: 97%

Molecular weight: 159.1631

Ref: IN-DA002JZB

(5-Nitrothiophen-2-yl)methanol

CAS: 20898-85-5

(5-Nitrothiophen-2-yl)methanol

Purity: 95%

Molecular weight: 159.16g/mol

Ref: 54-OR92727

(5-Nitrothiophen-2-yl)methanol

CAS: 20898-85-5

Purity: 97%+(GC-MS);RG

Molecular weight: 159.1600037

Ref: 10-F761214

(5-Nitrothiophen-2-yl)methanol

CAS: 20898-85-5

5-Nitrothiophen-2-yl)methanol is a synthetic compound that is used in the synthesis of prednisolone. It has been shown to be bioreductive, meaning that it can be reduced by cytochrome P450 enzymes and other reductases. 5-Nitrothiophen-2-yl)methanol reduces nitro groups on a variety of substrates, including steroids, which are conjugated with glutathione or glucuronic acid. This product also has been shown to reduce chloride ions inside cells and vessels, leading to vasoconstriction. The microenvironment around the tumor may lead to cancer development.

Formula: C₅H₅NO₃S

Purity: Min. 95%

Molecular weight: 159.17 g/mol

Ref: 3D-VAA89885