
CAS 2091-24-9: 4,7,10,13,16,19-Docosahexaenoic acid
Description:4,7,10,13,16,19-Docosahexaenoic acid (DHA) is a long-chain polyunsaturated fatty acid belonging to the omega-3 family. It is characterized by its 22 carbon atoms and six double bonds, which are positioned at specific intervals along the carbon chain. DHA is primarily found in marine sources, particularly in fish oils, and is a crucial component of phospholipids in neuronal membranes, playing a vital role in brain and retinal health. Its structure contributes to its fluidity and flexibility, essential for cellular function. DHA is known for its anti-inflammatory properties and is associated with various health benefits, including cardiovascular health and cognitive function. The substance is typically obtained through dietary sources or supplementation, as the human body can synthesize it from alpha-linolenic acid (ALA) but not in sufficient quantities. Due to its importance in human health, DHA is often emphasized in nutritional guidelines, particularly for pregnant women and infants, to support brain development.
Formula:C22H32O2
InChI:InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)
InChI key:InChIKey=MBMBGCFOFBJSGT-UHFFFAOYSA-N
SMILES:O=C(O)CCC=CCC=CCC=CCC=CCC=CCC=CCC
- Synonyms:
- 4,7,10,13,16,19-Docosahexaenoic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4,7,10,13,16,19-Docosahexaenoic acid REF: IN-DA002K1PCAS: 2091-24-9 | - - - | To inquire | Fri 11 Apr 25 |