CAS 209115-32-2

9H-fluoren-9-ylmethyl (4-hydroxybutyl)carbamate

Description:

9H-fluoren-9-ylmethyl (4-hydroxybutyl)carbamate, with the CAS number 209115-32-2, is a chemical compound that features a fluorenylmethyl group linked to a carbamate functional group. This compound is characterized by its unique structure, which includes a fluorenyl moiety, known for its stability and aromatic properties, contributing to its potential applications in organic synthesis and materials science. The presence of the 4-hydroxybutyl group introduces hydrophilicity and may enhance solubility in polar solvents, making it suitable for various chemical reactions and formulations. Additionally, the carbamate functional group is known for its reactivity, particularly in the formation of amides and esters, and can serve as a protective group in organic synthesis. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 9H-fluoren-9-ylmethyl (4-hydroxybutyl)carbamate is of interest in research and development within the fields of medicinal chemistry and polymer science.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1/C19H21NO3/c21-12-6-5-11-20-19(22)23-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18,21H,5-6,11-13H2,(H,20,22)

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=NCCCCO)O

Synonyms:

• 9H-fluoren-9-ylmethyl N-(4-hydroxybutyl)carbamate

9H-Fluoren-9-ylmethyl N-(4-hydroxybutyl)carbamate

CAS: 209115-32-2

Formula: C₁₉H₂₁NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 311.3749

Ref: IN-DA002K20

N-(Fluoren-9-ylmethoxycarbonyl)-4-aminobutan-1-ol

CAS: 209115-32-2

N-(Fluoren-9-ylmethoxycarbonyl)-4-aminobutan-1-ol

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 311.37g/mol

Ref: 54-OR0484

(9H-fluoren-9-yl)methyl (4-hydroxybutyl)carbamate

CAS: 209115-32-2

Purity: 95%

Molecular weight: 311.3810119628906

Ref: 10-F725145