CymitQuimica logo

CAS 209115-33-3

:

9H-Fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate

Description:
9H-Fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate, with the CAS number 209115-33-3, is a chemical compound that features a fluorenylmethyl group linked to a carbamate moiety. This compound is characterized by its unique structure, which includes a fluorenyl ring system known for its stability and aromatic properties, contributing to its potential applications in organic synthesis and medicinal chemistry. The presence of the N-(5-hydroxypentyl) substituent introduces a hydrophilic element, which may enhance solubility in polar solvents and influence biological interactions. The carbamate functional group is known for its reactivity and ability to form hydrogen bonds, making this compound potentially useful in drug design and development. Additionally, the compound may exhibit interesting pharmacological properties due to its structural features, although specific biological activity would require further investigation. Overall, this compound represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and materials science.
Formula:C20H23NO3
InChI:InChI=1S/C20H23NO3/c22-13-7-1-6-12-21-20(23)24-14-19-17-10-4-2-8-15(17)16-9-3-5-11-18(16)19/h2-5,8-11,19,22H,1,6-7,12-14H2,(H,21,23)
InChI key:InChIKey=YNOWFUNORLDFTH-UHFFFAOYSA-N
SMILES:C(OC(NCCCCCO)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • Carbamic acid, (5-hydroxypentyl)-, 9H-fluoren-9-ylmethyl ester
  • 9H-Fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate
  • Carbamic acid, N-(5-hydroxypentyl)-, 9H-fluoren-9-ylmethyl ester
Found 4 products.