CAS 209128-50-7
:(1R,2R)-2-[(tert-butoxycarbonyl)amino]cyclohexanecarboxylic acid
Description:
(1R,2R)-2-[(tert-butoxycarbonyl)amino]cyclohexanecarboxylic acid is a chiral amino acid derivative characterized by its cyclohexane ring structure, which contributes to its unique stereochemistry. The presence of the tert-butoxycarbonyl (Boc) group serves as a protective group for the amino functionality, making it useful in peptide synthesis and other organic reactions. This compound typically exhibits solubility in polar organic solvents due to the presence of both hydrophobic (the cyclohexane ring and tert-butyl group) and hydrophilic (the carboxylic acid and amino groups) components. Its chirality allows for specific interactions in biological systems, which can be significant in pharmaceutical applications. The compound's stability and reactivity can be influenced by the pH of the environment, particularly due to the carboxylic acid group, which can exist in protonated or deprotonated forms depending on the conditions. Overall, (1R,2R)-2-[(tert-butoxycarbonyl)amino]cyclohexanecarboxylic acid is a valuable intermediate in organic synthesis, particularly in the development of biologically active compounds.
Formula:C12H21NO4
InChI:InChI=1/C12H21NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8(9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9-/m1/s1
SMILES:CC(C)(C)OC(=N[C@@H]1CCCC[C@H]1C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
trans-2-(Boc-amino)cyclohexanecarboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H21NO4Purity:97%Color and Shape:White crystalline, SolidMolecular weight:243.30trans-2-tert-Butoxycarbonylamino-cyclohexanecarboxylic acid
CAS:trans-2-tert-Butoxycarbonylamino-cyclohexanecarboxylic acidPurity:98%Molecular weight:243.30g/moltrans-2-((tert-Butoxycarbonyl)amino)-cyclohexanecarboxylic acid
CAS:Formula:C12H21NO4Purity:98%Color and Shape:CrystallineMolecular weight:243.147




