CAS 20924-05-4
:thymine-1-acetic acid
Description:
Thymine-1-acetic acid, with the CAS number 20924-05-4, is a derivative of thymine, one of the four nucleobases in DNA. This compound features an acetic acid functional group attached to the 1-position of the thymine ring structure. Thymine itself is a pyrimidine base, characterized by its aromatic ring and nitrogen-containing functional groups. The addition of the acetic acid moiety introduces a carboxylic acid group, which can influence the compound's solubility and reactivity. Thymine-1-acetic acid may exhibit properties typical of both nucleobases and carboxylic acids, such as potential hydrogen bonding and acidity. It is likely to be soluble in polar solvents due to the presence of the acetic acid group. This compound may be of interest in biochemical research, particularly in studies related to nucleic acid interactions or modifications. However, specific applications and biological activities would require further investigation to fully understand its role and utility in various chemical and biological contexts.
Formula:C7H8N2O4
InChI:InChI=1/C7H8N2O4/c1-4-2-9(3-5(10)11)7(13)8-6(4)12/h2H,3H2,1H3,(H,10,11)(H,8,12,13)
SMILES:Cc1cn(CC(=O)O)c(=O)nc1O
Synonyms:- (5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Thymine-1-acetic Acid
CAS:Formula:C7H8N2O4Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:184.151(2H)-Pyrimidineacetic acid, 3,4-dihydro-5-methyl-2,4-dioxo-
CAS:Formula:C7H8N2O4Purity:95%Color and Shape:SolidMolecular weight:184.1494Thymin-1-ylacetic acid
CAS:Thymin-1-ylacetic acidFormula:C7H8N2O4Purity:98%Color and Shape: white solidMolecular weight:184.15g/molThymin-1-yl acetic acid
CAS:Thymin-1-yl acetic acid is a PNA-related Derivative; PNA monomer.Formula:C7H8N2O4Color and Shape:SolidMolecular weight:184.15Ref: TM-TNU0888
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire(5-Methyl-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)acetic acid
CAS:Formula:C7H8N2O4Purity:95%Color and Shape:SolidMolecular weight:184.151




