CAS 20924-56-5
:1H-isochromen-4(3H)-one
Description:
1H-Isochromen-4(3H)-one, with the CAS number 20924-56-5, is a chemical compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to a lactone. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activities, including anti-inflammatory and antioxidant properties. Its reactivity can be attributed to the presence of the carbonyl group, which can participate in various chemical reactions, such as nucleophilic additions. Additionally, 1H-isochromen-4(3H)-one can serve as a precursor for the synthesis of more complex molecules, making it valuable in the development of pharmaceuticals and agrochemicals. Overall, its structural features and reactivity contribute to its significance in chemical research and applications.
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2
SMILES:c1ccc2c(c1)COCC2=O
Synonyms:- 1H-2-Benzopyran-4(3H)-one
- Isochroman-4-One
- 3,4-dihydro-1H-2-benzopyran-4-one
- 1H-isochromen-4-ol
- 1H-isochromen-4-one
- isochroman-4-one 1H-isochromen-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isochroman-4-one
CAS:Isochroman-4-one is a chemical compound that contains a pyridine ring. It has been found to have antihypertensive activity in vivo and in vitro. The mechanism of action is not known, but it may be due to its ability to inhibit angiotensin II type 1 receptor (AT1R) signaling. Isochroman-4-one also shows significant affinity for the hepg2 cell line and an endophytic fungus that produces quinoline derivatives. This molecule is enantioselective, which means it can be differentiated from other compounds with the same molecular formula by its different spatial arrangement of atoms within the molecule. The two enantiomers are called R and S. The isochroman-4-one structure has been modeled using computational chemistry methods, including quantum calculations and molecular dynamics simulations.Formula:C9H8O2Purity:Min. 95%Molecular weight:148.16 g/mol
