CAS 20925-24-0

2-(dimethylamino)benzonitrile

Description:

2-(Dimethylamino)benzonitrile, with the CAS number 20925-24-0, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a dimethylamino group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the benzene ring. The dimethylamino group contributes to its basicity and can participate in various chemical reactions, including nucleophilic substitutions. It is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or other chemical compounds. The presence of the nitrile functional group (-C≡N) imparts unique reactivity, allowing for further transformations such as hydrolysis or reduction. Additionally, 2-(dimethylamino)benzonitrile may exhibit specific solubility characteristics, typically being soluble in organic solvents while having limited solubility in water. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₉H₁₀N₂

InChI: InChI=1/C9H10N2/c1-11(2)9-6-4-3-5-8(9)7-10/h3-6H,1-2H3

SMILES: CN(C)c1ccccc1C#N

Synonyms:

• Benzonitrile, 2-(dimethylamino)-
• 2-(Dimethylamino)benzonitrile

Benzonitrile, 2-(dimethylamino)-

CAS: 20925-24-0

Formula: C₉H₁₀N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 146.1891

Ref: IN-DA002K55

2-(Dimethylamino)benzonitrile

CAS: 20925-24-0

2-(Dimethylamino)benzonitrile

Purity: 95%

Color and Shape: Liquid

Molecular weight: 146.19g/mol

Ref: 54-OR6854

2-Dimethylamino-benzonitrile

CAS: 20925-24-0

Formula: C₉H₁₀N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 146.193

Ref: 10-F033396

2-(Dimethylamino)benzonitrile

CAS: 20925-24-0

2-(Dimethylamino)benzonitrile is an alicyclic molecule that has been shown to have a transfer mechanism. It is a reactive compound and has been used as a polymerization initiator for polymers. The cavity in the molecule can be filled with other molecules, forming complexes. 2-(Dimethylamino)benzonitrile is also used to synthesize metal carbonyls, which are compounds with high energy efficiency. 2-(Dimethylamino)benzonitrile has been shown to have anti-inflammatory properties due to its ability to inhibit prostaglandin synthesis.

Formula: C₉H₁₀N₂

Purity: Min. 95%

Molecular weight: 146.19 g/mol

Ref: 3D-VAA92524