CAS 209286-73-7

1-chloro-6-methylisoquinoline

Description:

1-Chloro-6-methylisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the first position and a methyl group at the sixth position of the isoquinoline framework defines its unique properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with isoquinoline derivatives. Additionally, 1-chloro-6-methylisoquinoline may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₁₀H₈ClN

InChI: InChI=1/C10H8ClN/c1-7-2-3-9-8(6-7)4-5-12-10(9)11/h2-6H,1H3

SMILES: Cc1ccc2c(ccnc2Cl)c1

Synonyms:

• Isoquinoline, 1-chloro-6-methyl-
• 1-Chloro-6-methylisoquinoline

Isoquinoline, 1-chloro-6-methyl-

CAS: 209286-73-7

Formula: C₁₀H₈ClN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 177.6302

Ref: IN-DA002K66

1-Chloro-6-methylisoquinoline

CAS: 209286-73-7

1-Chloro-6-methylisoquinoline

Formula: C₁₀H₈ClN

Purity: 97%

Color and Shape: light yellow liquid

Molecular weight: 177.63g/mol

Ref: 54-OR951758

1-Chloro-6-methylisoquinoline

CAS: 209286-73-7

Formula: C₁₀H₈ClN

Purity: 95%

Molecular weight: 177.63

Ref: 10-F237654

1-Chloro-6-methylisoquinoline

Controlled Product

CAS: 209286-73-7

Applications 1-Chloro-6-methylisoquinoline (cas# 209286-73-7) is a useful research chemical.

Formula: C₁₀H₈ClN

Color and Shape: Neat

Molecular weight: 177.63

Ref: TR-C384820