CAS 2093-31-4
:3-(1,5-dimethyl-3-propylpyrrolidin-3-yl)phenyl acetate
Description:
3-(1,5-Dimethyl-3-propylpyrrolidin-3-yl)phenyl acetate, with the CAS number 2093-31-4, is a chemical compound that belongs to the class of phenyl acetates. This substance features a phenyl group attached to an acetate moiety, along with a pyrrolidine ring that is substituted with two methyl groups and a propyl group. The presence of the pyrrolidine ring suggests potential biological activity, as many compounds with similar structures are known to interact with biological systems. The molecular structure indicates that it may exhibit lipophilic properties, which could influence its solubility and permeability in biological membranes. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and reactivity, would typically be determined through experimental methods or detailed literature reviews. Safety data sheets would provide essential information regarding handling, toxicity, and environmental impact.
Formula:C17H25NO2
InChI:InChI=1/C17H25NO2/c1-5-9-17(11-13(2)18(4)12-17)15-7-6-8-16(10-15)20-14(3)19/h6-8,10,13H,5,9,11-12H2,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenol, m-(1,5-dimethyl-3-propyl-3-pyrrolidinyl)-, acetate
CAS:Phenol, m-(1,5-dimethyl-3-propyl-3-pyrrolidinyl)-, acetate is a bioactive chemical.Formula:C17H25NO2Color and Shape:SolidMolecular weight:275.39
