CAS 2093153-09-2: 16-(3,6,9,12-Tetraoxapentadec-14-yn-1-yl)-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontanedioic acid

Description:The chemical substance known as "16-(3,6,9,12-Tetraoxapentadec-14-yn-1-yl)-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontanedioic acid" with CAS number 2093153-09-2 is a complex organic molecule characterized by a long carbon chain and multiple functional groups. It features a series of ether linkages, indicated by the presence of multiple oxo groups, which contribute to its solubility and potential applications in various fields, including materials science and biochemistry. The presence of azahentriacontanedioic acid suggests that it may exhibit properties typical of polycarboxylic acids, such as acidity and the ability to form salts or esters. The structural complexity, including the tetraoxapentadec-14-yn-1-yl substituent, implies potential reactivity and specificity in interactions with biological systems or other chemical entities. Overall, this compound's unique structure may enable it to serve as a versatile building block in synthetic chemistry or as a functional agent in drug delivery systems.

Formula:C₃₃H₆₁NO₁₆

InChI:InChI=1S/C33H61NO16/c1-2-8-39-14-20-45-26-29-48-23-17-42-11-5-34(6-12-43-18-24-49-30-27-46-21-15-40-9-3-32(35)36)7-13-44-19-25-50-31-28-47-22-16-41-10-4-33(37)38/h1H,3-31H2,(H,35,36)(H,37,38)

InChI key:InChIKey=QTELQFWGTOEVNF-UHFFFAOYSA-N

SMILES:O=C(O)CCOCCOCCOCCOCCN(CCOCCOCCOCCOCC#C)CCOCCOCCOCCOCCC(=O)O

Synonyms:
16-(3,6,9,12-Tetraoxapentadec-14-yn-1-yl)-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontanedioic acid
4,7,10,13,19,22,25,28-Octaoxa-16-azahentriacontanedioic acid, 16-(3,6,9,12-tetraoxapentadec-14-yn-1-yl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	N-(Propargyl-PEG4)-N-bis(PEG4-acid) REF: TM-T16249CAS: 2093153-09-2	98%	To inquire	Tue 06 May 25
	N-(Propargyl-PEG4)-N-bis(PEG4-acid) hydrochloride REF: 3D-TID15309CAS: 2093153-09-2	Min. 95%	- - -	Discontinued product