CAS 209347-94-4
:5-bromo-6-chloro-1H-indol-3-yl octanoate
Description:
5-Bromo-6-chloro-1H-indol-3-yl octanoate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of bromine and chlorine substituents at the 5 and 6 positions, respectively, contributes to its unique reactivity and potential biological activity. The octanoate group, derived from octanoic acid, adds a hydrophobic tail that can influence the compound's solubility and membrane permeability. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in various applications, including anti-cancer research or as a biochemical probe. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity, particularly in biological systems. Overall, 5-bromo-6-chloro-1H-indol-3-yl octanoate represents a complex molecule with diverse potential applications in scientific research.
Formula:C16H19BrClNO2
InChI:InChI=1/C16H19BrClNO2/c1-2-3-4-5-6-7-16(20)21-15-10-19-14-9-13(18)12(17)8-11(14)15/h8-10,19H,2-7H2,1H3
SMILES:CCCCCCCC(=O)Oc1c[nH]c2cc(c(cc12)Br)Cl
Synonyms:- 5-Bromo-6-chloro-3-indolyl caprylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-6-chloro-3-indolyl caprylate
CAS:5-Bromo-6-chloro-3-indolyl caprylateFormula:C16H19BrClNO2Purity:By hplc: 99.6% (Typical Value in Batch COA)Color and Shape: almost white powderMolecular weight:372.68456g/mol5-Bromo-6-chloro-3-indoxyl caprylate, Patent WO 2022/038120
CAS:<p>5-Bromo-6-chloro-3-indolyl caprylate is also known as magenta caprylate. Upon the cleavage of the ester bond in the substrate by esterase enzymes, 5-bromo-6-chloro-1H-indol-3-ol is released. When exposed to oxygen (such as in the air) this undergoes dimerization to form 5,5'-dibromo-6,6'-dicholoro-indigo, which is a magenta coloured chromophore (λmax 565nm). Bacteria such as Salmonella and some Klebsiella and Enterobacter produce caprylate esterase and so this substrate can be used for the detection of these bacteria in samples, such as in food. This product is patent pending, as polymorphs of this product can have different physicochemical properties and can improve solubility and stability. Cymit Quimica is able to product high quality, stable product to detect esterase enzyme activity.</p>Formula:C16H19BrClNO2Purity:Min. 99.0 Area-%Molecular weight:372.7 g/mol5-Bromo-6-Chloro-3-Indolyl-Caprylate (Magenta Caprylate) extrapure, 97%
CAS:Formula:C16H19BrClNO2Purity:min. 97%Color and Shape:White, Powder, Clear, colourlessMolecular weight:372.685-Bromo-6-chloro-3-indolyl caprylate
CAS:<p>M04068 - 5-Bromo-6-chloro-3-indolyl caprylate</p>Formula:C16H19BrClNO2Purity:97%Color and Shape:SolidMolecular weight:372.69Octanoic acid, 5-bromo-6-chloro-1H-indol-3-yl ester
CAS:Formula:C16H19BrClNO2Purity:98%Molecular weight:372.6846




