CAS 20939-15-5

4-Amino-5-methyl-4H-1,2,4-triazole-3-thiol

Description:

4-Amino-5-methyl-4H-1,2,4-triazole-3-thiol, with the CAS number 20939-15-5, is a heterocyclic compound characterized by the presence of a triazole ring, an amino group, and a thiol functional group. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. The amino group (-NH2) contributes to its basicity, while the thiol group (-SH) imparts reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and redox reactions. It is often used in agricultural chemistry as a fungicide and in the synthesis of other organic compounds. The presence of the methyl group enhances its lipophilicity, which can influence its biological activity and interaction with other substances. Additionally, the compound may exhibit antimicrobial properties, making it of interest in pharmaceutical applications. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₃H₆N₄S

InChI: InChI=1/C3H6N4S/c1-2-5-6-3(8)7(2)4/h4H2,1H3,(H,6,8)

SMILES: Cc1nnc(n1N)S

4-Amino-5-methyl-4H-1,2,4-triazole-3-thiol

CAS: 20939-15-5

Formula: C₃H₆N₄S

Color and Shape: Solid

Molecular weight: 130.1715

Ref: IN-DA00I405

4-Amino-5-methyl-4H-1,2,4-triazole-3-thiol

CAS: 20939-15-5

4-Amino-5-methyl-4H-1,2,4-triazole-3-thiol

Purity: ≥95%

Ref: 54-OR26178

4-Amino-5-methyl-4H-1,2,4-triazole-3-thiol

CAS: 20939-15-5

Formula: C₃H₆N₄S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 130.17

Ref: 10-F009881