CAS 2094-74-8: tricyclo[3.3.1.13,7]decane-1-carbaldehyde

Description:Tricyclo[3.3.1.1^3,7]decane-1-carbaldehyde, with the CAS number 2094-74-8, is a bicyclic organic compound characterized by its unique tricyclic structure. This compound features a decane backbone with a carbaldehyde functional group (-CHO) at the first position, which contributes to its reactivity and potential applications in organic synthesis. The tricyclic framework imparts rigidity to the molecule, influencing its physical properties such as boiling and melting points, as well as its solubility in various solvents. Typically, compounds like this may exhibit interesting stereochemistry and can participate in various chemical reactions, including nucleophilic additions due to the presence of the aldehyde group. Additionally, the compound may have implications in the field of medicinal chemistry or materials science, depending on its specific reactivity and interactions with biological systems or other materials. Overall, tricyclo[3.3.1.1^3,7]decane-1-carbaldehyde is a notable example of a complex organic molecule with potential utility in various chemical applications.

Formula:C₁₁H₁₆O

InChI:InChI=1/C11H16O/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h7-10H,1-6H2

Synonyms:
Adamantane-1-carbaldehyde
Tricyclo[3.3.1.13,7]decane-1-carboxaldehyde
1-Adamantane Carboxaldehyde

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Tricyclo[3.3.1.13,7]decane-1-carboxaldehyde REF: IN-DA002K8CCAS: 2094-74-8	95%	To inquire	Mon 14 Apr 25
Adamantane-1-carboxaldehyde REF: 54-OR315781CAS: 2094-74-8	97%	55.00 €~3,221.00 €	Tue 15 Apr 25
1-Adamantanecarboxaldehyde REF: 10-F223552CAS: 2094-74-8	95.0%	To inquire	Thu 24 Apr 25
1-Adamantylcarboxaldehyde REF: TR-A208600CAS: 2094-74-8	- - -	335.00 €~1,215.00 €	Tue 27 May 25
1-Adamantane carboxaldehyde REF: 3D-FA08990CAS: 2094-74-8	Min. 95%	2,309.00 €~3,460.00 €	Mon 07 Jul 25