CAS 2094-74-8

tricyclo[3.3.1.13,7]decane-1-carbaldehyde

Description:

Tricyclo[3.3.1.1^3,7]decane-1-carbaldehyde, with the CAS number 2094-74-8, is a bicyclic organic compound characterized by its unique tricyclic structure. This compound features a decane backbone with a carbaldehyde functional group (-CHO) at the first position, which contributes to its reactivity and potential applications in organic synthesis. The tricyclic framework imparts rigidity to the molecule, influencing its physical properties such as boiling and melting points, as well as its solubility in various solvents. Typically, compounds like this may exhibit interesting stereochemistry and can participate in various chemical reactions, including nucleophilic additions due to the presence of the aldehyde group. Additionally, the compound may have implications in the field of medicinal chemistry or materials science, depending on its specific reactivity and interactions with biological systems or other materials. Overall, tricyclo[3.3.1.1^3,7]decane-1-carbaldehyde is a notable example of a complex organic molecule with potential utility in various chemical applications.

Formula: C₁₁H₁₆O

InChI: InChI=1/C11H16O/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h7-10H,1-6H2

SMILES: C1C2CC3CC1CC(C2)(C3)C=O

Synonyms:

• Adamantane-1-carbaldehyde
• Tricyclo[3.3.1.13,7]decane-1-carboxaldehyde
• 1-Adamantane Carboxaldehyde

1-Adamantane carboxaldehyde

CAS: 2094-74-8

Formula: C₁₁H₁₆O

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.2441

Ref: IN-DA002K8C

Adamantane-1-carboxaldehyde

CAS: 2094-74-8

Adamantane-1-carboxaldehyde

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.24g/mol

Ref: 54-OR315781

1-Adamantanecarboxaldehyde

CAS: 2094-74-8

Formula: C₁₁H₁₆O

Purity: >95%

Color and Shape: Solid

Molecular weight: 164.248

Ref: 10-F223552

1-Adamantylcarboxaldehyde

Controlled Product

CAS: 2094-74-8

Formula: C₁₁H₁₆O

Color and Shape: Neat

Molecular weight: 164.24

Ref: TR-A208600

1-Adamantylcarboxaldehyde

CAS: 2094-74-8

Formula: C₁₁H₁₆O

Molecular weight: 164.25

Ref: ST-EA-CP-S19028

1-Adamantane carboxaldehyde

CAS: 2094-74-8

1-Adamantane carboxaldehyde is a synthetic chemical that is used in the amination reaction, allylation, and halide exchange. It is made by reacting methylcyclopentane with trifluoromethanesulfonic acid. 1-Adamantane carboxaldehyde has been shown to be an efficient aminating agent in the synthesis of various amines. This compound reacts with chloride to form an intermediate that can be protonated. The protonated intermediate then reacts with an electrophile to form a new carbon-carbon bond. It also has the ability to react with sulfides, thiols, and alcohols. 1-Adamantane carboxaldehyde can be synthesized using techniques such as carbonyl group activation or functional theory techniques such as infrared spectroscopy and nuclear magnetic resonance spectroscopy.

Formula: C₁₁H₁₆O

Purity: Min. 95%

Molecular weight: 164.24 g/mol

Ref: 3D-FA08990