CAS 20945-65-7

2-chloro-4-(methylsulfonyl)phenol

Description:

2-Chloro-4-(methylsulfonyl)phenol, with the CAS number 20945-65-7, is an organic compound characterized by its phenolic structure, which includes a chlorine atom and a methylsulfonyl group attached to the aromatic ring. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chlorine atom contributes to its reactivity, while the methylsulfonyl group enhances its solubility in polar solvents. It exhibits properties such as antimicrobial activity, making it of interest in the development of biocides and fungicides. Additionally, the compound's stability under standard conditions allows for its use in various chemical reactions and formulations. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 2-chloro-4-(methylsulfonyl)phenol is a versatile compound with significant relevance in chemical research and industrial applications.

Formula: C₇H₇ClO₃S

InChI: InChI=1/C7H7ClO3S/c1-12(10,11)5-2-3-7(9)6(8)4-5/h2-4,9H,1H3

SMILES: CS(=O)(=O)c1ccc(c(c1)Cl)O

2-Chloro-4-(methylsulfonyl)phenol

CAS: 20945-65-7

Formula: C₇H₇ClO₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.6467

Ref: IN-DA002K8X

2-Chloro-4-(methylsulfonyl)phenol

CAS: 20945-65-7

2-Chloro-4-(methylsulfonyl)phenol

Purity: 95%

Molecular weight: 206.65g/mol

Ref: 54-OR1046762

2-Chloro-4-(methylsulfonyl)phenol

CAS: 20945-65-7

Formula: C₇H₇ClO₃S

Purity: 95.0%

Molecular weight: 206.64

Ref: 10-F329536

2-chloro-4-methanesulfonylphenol

CAS: 20945-65-7

2-Chloro-4-methanesulfonylphenol (CMSP) is a hydroxylated aromatic compound that is used as a reagent for the determination of benzene. CMSP is also an important intermediate in the synthesis of triketones, which are used as herbicides and pesticides. The most common method of producing CMSP is by ozonation of benzene, followed by reaction with sulfuric acid. This process can be monitored using gas chromatography and mass spectrometry to measure the amount of CMSP produced. The photocatalytic degradation of CMSP has been studied using orbitrap mass spectrometry and liquid chromatography tandem mass spectrometry.

Formula: C₇H₇ClO₃S

Purity: Min. 95%

Molecular weight: 206.64 g/mol

Ref: 3D-VAA94565