CAS 209480-63-7

SB 258585

Description:

SB 258585, with the CAS number 209480-63-7, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is known to act as a selective inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth and division. The compound's structure typically features specific functional groups that contribute to its biological activity and selectivity. In preclinical studies, SB 258585 has shown promise in modulating signaling pathways associated with diseases such as cancer, making it a candidate for further investigation in drug development. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME), are essential for understanding its efficacy and safety profile. As research continues, the detailed mechanisms of action and potential side effects will be elucidated, providing insights into its therapeutic potential and applications in clinical settings.

Formula: C₁₈H₂₂IN₃O₃S

InChI: InChI=1S/C18H22IN3O3S/c1-21-9-11-22(12-10-21)17-13-15(5-8-18(17)25-2)20-26(23,24)16-6-3-14(19)4-7-16/h3-8,13,20H,9-12H2,1-2H3

InChI key: InChIKey=BDHMSYNBSBZCAF-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(NS(=O)(=O)C2=CC=C(I)C=C2)C=C1)N3CCN(C)CC3

Synonyms:

• Benzenesulfonamide, 4-iodo-N-[4-methoxy-3-(4-methyl-1-piperazinyl)phenyl]-
• SB 258585
• 4-Iodo-N-[4-methoxy-3-(4-methyl-1-piperazinyl)phenyl]benzenesulfonamide

Benzenesulfonamide, 4-iodo-N-[4-methoxy-3-(4-methyl-1-piperazinyl)phenyl]-

CAS: 209480-63-7

Formula: C₁₈H₂₂IN₃O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 487.3550

Ref: IN-DA002K9B

SB 258585

CAS: 209480-63-7

SB 258585

Purity: ≥98%

Molecular weight: 487.36g/mol

Ref: 54-BUP08300

SB 258585

CAS: 209480-63-7

SB 258585: Selective 5-HT6 antagonist, binds human receptors, used in cognitive and antipsychotic assays.

Formula: C₁₈H₂₂IN₃O₃S

Purity: 99.77%

Color and Shape: Soild

Molecular weight: 487.36

Ref: TM-T23318L

SB 258585

Controlled Product

CAS: 209480-63-7

Formula: C₁₈H₂₂IN₃O₃S

Color and Shape: Neat

Molecular weight: 487.355

Ref: TR-S155038