CAS 209481-24-3

5-Chloro-N-[4-methoxy-3-(1-piperazinyl)phenyl]-3-methylbenzo[b]thiophene-2-sulfonamide hydrochloride

Description:

5-Chloro-N-[4-methoxy-3-(1-piperazinyl)phenyl]-3-methylbenzo[b]thiophene-2-sulfonamide hydrochloride is a synthetic compound characterized by its complex structure, which includes a benzo[b]thiophene core, a sulfonamide functional group, and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of chlorine and methoxy groups can influence its pharmacokinetic properties, including absorption and distribution. The sulfonamide group is known for its antibacterial properties, while the piperazine ring may contribute to its interaction with biological targets. As a hydrochloride salt, it is likely to be more stable and easier to handle in laboratory settings. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, although specific biological activity and therapeutic efficacy would require further investigation through experimental studies.

Formula: C₂₀H₂₃Cl₂N₃O₃S₂

InChI: InChI=1/C20H22ClN3O3S2.ClH/c1-13-16-11-14(21)3-6-19(16)28-20(13)29(25,26)23-15-4-5-18(27-2)17(12-15)24-9-7-22-8-10-24;/h3-6,11-12,22-23H,7-10H2,1-2H3;1H

SMILES: Cc1c2cc(ccc2sc1S(=O)(=O)Nc1ccc(c(c1)N1CCNCC1)OC)Cl.Cl

Synonyms:

• Sb-271046
• 5-chloro-N-(4-methoxy-3-piperazin-1-ylphenyl)-3-methyl-1-benzothiophene-2-sulfonamide hydrochloride

SB 271046 HCl

CAS: 209481-24-3

Formula: C₂₀H₂₃Cl₂N₃O₃S₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 488.4509

Ref: IN-DA00BEB0

SB 271046 hydrochloride

CAS: 209481-24-3

SB 271046 hydrochloride

Purity: ≥98%

Molecular weight: 488.45g/mol

Ref: 54-BUP10205

SB-271046A

CAS: 209481-24-3

Formula: C₂₀H₂₂ClN₃O₃S₂·HCl

Molecular weight: 488.45

Ref: 7W-GK6872

SB 271046 hydrochloride

CAS: 209481-24-3

5-HT6 serotonin receptor antagonist; anti-convulsant

Formula: C₂₀H₂₂CIN₃O₃S₂·HCl

Purity: Min. 95%

Molecular weight: 591.91 g/mol

Ref: 3D-FS65160

SB 271046 hydrochloride

CAS: 209481-24-3

SB 271046 hydrochloride (SB 271046A) is selective, orally active 5-HT6 antagonist and is > 200-fold selective over 55 other receptors, enzymes and ion channels.

Formula: C₂₀H₂₂ClN₃O₃S₂·HCl

Purity: 99.77%

Color and Shape: Solid

Molecular weight: 488.45

Ref: TM-T4118