CAS 20950-52-1
:3,7-dimethoxy-2-phenyl-4H-chromen-4-one
Description:
3,7-Dimethoxy-2-phenyl-4H-chromen-4-one, also known by its CAS number 20950-52-1, is a synthetic organic compound belonging to the flavonoid class of compounds. This substance features a chromone backbone, characterized by a benzopyran structure, which is further substituted with two methoxy groups at the 3 and 7 positions and a phenyl group at the 2 position. The presence of these substituents contributes to its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The compound is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the methoxy groups enhance its lipophilicity, which can influence its absorption and distribution in biological systems. Overall, 3,7-dimethoxy-2-phenyl-4H-chromen-4-one is a compound of significant interest for further research in the fields of natural products and drug development.
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-19-12-8-9-13-14(10-12)21-16(17(20-2)15(13)18)11-6-4-3-5-7-11/h3-10H,1-2H3
SMILES:COc1ccc2c(c1)oc(c1ccccc1)c(c2=O)OC
Synonyms:- 3,7-Dmethoxy-2-phenyl-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,7-Dimethoxyflavone
CAS:3,7-Dimethoxyflavone is a naturally occurring flavone, which is a type of polyphenolic compound. It is sourced from various plant species, notably those within the genus *Kaempferia*, and can also be synthesized in laboratory settings. The compound is characterized by its distinct chemical structure, featuring methoxy groups at the 3 and 7 positions on the flavone backbone.
Formula:C17H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:282.29 g/mol3,7-DMF
CAS:3,7-Dimethylfumarate (3,7-DMF) serves as an oral inhibitor of transforming growth factor-beta 1 (TGF-β1)-mediated hepatic stellate cell (HSC) activation.Formula:C17H14O4Purity:98%Color and Shape:SolidMolecular weight:282.29


