CAS 20950-84-9
:N-(2-Aminoethyl)carbamodithioic acid
Description:
N-(2-Aminoethyl)carbamodithioic acid, also known by its CAS number 20950-84-9, is an organic compound characterized by the presence of both amino and dithioic acid functional groups. This compound features a carbamodithioic acid backbone, which includes a thiol (-SH) group, contributing to its reactivity and potential applications in various chemical processes. It is typically a white to off-white solid, soluble in water and polar organic solvents, which enhances its utility in biological and chemical applications. The aminoethyl group provides basic properties, allowing it to participate in various reactions, including nucleophilic substitutions and coordination with metal ions. Due to its functional groups, this compound may exhibit biological activity, making it of interest in medicinal chemistry and biochemistry. Additionally, its ability to form complexes with metals suggests potential applications in catalysis and materials science. Safety data should be consulted for handling, as compounds with thiol groups can be sensitive to oxidation and may have specific toxicity profiles.
Formula:C3H8N2S2
InChI:InChI=1S/C3H8N2S2/c4-1-2-5-3(6)7/h1-2,4H2,(H2,5,6,7)
InChI key:InChIKey=NJGRNRAXMBFJJY-UHFFFAOYSA-N
SMILES:N(C(=S)S)CCN
Synonyms:- (2-Aminoethyl)dithiocarbamic acid
- Carbamic acid, (2-aminoethyl)dithio-
- Carbamodithioic acid, (2-aminoethyl)-
- N-(2-Aminoethyl)carbamodithioic acid
- NSC 83224
- Preparation 275
- beta-Aminoethyldithiocarbamic acid
- carbamodithioic acid, N-(2-aminoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
