CAS 2095192-09-7

7-Azabicyclo[2.2.1]heptane-7-carboxylic acid, 2-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1), (1R,2S,4S)-rel-

Description:

7-Azabicyclo[2.2.1]heptane-7-carboxylic acid, 2-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1), (1R,2S,4S)-rel- is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. This substance features a carboxylic acid moiety and an amino group, indicating potential for various interactions and reactivity. The presence of the 1,1-dimethylethyl ester suggests that it may exhibit lipophilic properties, which can influence its solubility and bioavailability. The hydrochloride form indicates that the compound is a salt, which typically enhances its stability and solubility in aqueous solutions. The specific stereochemistry (1R,2S,4S) denotes the spatial arrangement of atoms, which can significantly affect the compound's biological activity and pharmacological properties. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₁₁H₂₀N₂O₂·ClH

InChI: InChI=1/C11H20N2O2.ClH/c1-11(2,3)15-10(14)13-7-4-5-9(13)8(12)6-7;/h7-9H,4-6,12H2,1-3H3;1H/t7-,8-,9+;/s2

InChI key: InChIKey=XGKKKCQEYSLZAJ-PJCWQIKONA-N

SMILES: C(OC(C)(C)C)(=O)N1[C@]2([C@@H](N)C[C@@]1(CC2)[H])[H].Cl

Synonyms:

• 7-Azabicyclo[2.2.1]heptane-7-carboxylic acid, 2-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1), (1R,2S,4S)-rel-

tert-butyl rac-(1S,2R,4R)-2-amino-7-azabicyclo[2.2.1]heptane-7-carboxylate hydrochloride

CAS: 2095192-09-7

Formula: C₁₁H₂₁ClN₂O₂

Purity: 95.0%

Molecular weight: 248.75

Ref: 10-F541540