CAS 2095192-17-7

3,7,11-Triazaspiro[5.6]dodecan-12-one, 7-methyl-, hydrochloride (1:2)

Description:

3,7,11-Triazaspiro[5.6]dodecan-12-one, 7-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which incorporates three nitrogen atoms within a dodecane framework. This compound features a ketone functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the hydrochloride indicates that it exists as a salt, which can enhance its solubility in water and influence its pharmacokinetic properties. The methyl group at the 7-position may affect the compound's biological activity and steric properties. As a triazole derivative, it may exhibit interesting biological activities, making it a candidate for further research in drug development. Its CAS number, 2095192-17-7, allows for precise identification in chemical databases. Overall, this compound's structural features suggest potential utility in various chemical and pharmaceutical applications, although specific biological activities and properties would require empirical investigation.

Formula: C₁₀H₁₉N₃O·2ClH

InChI: InChI=1S/C10H19N3O.2ClH/c1-13-8-2-5-12-9(14)10(13)3-6-11-7-4-10;;/h11H,2-8H2,1H3,(H,12,14);2*1H

InChI key: InChIKey=QCCMBJRUOQTJAQ-UHFFFAOYSA-N

SMILES: O=C1C2(N(C)CCCN1)CCNCC2.Cl

Synonyms:

• 3,7,11-Triazaspiro[5.6]dodecan-12-one, 7-methyl-, hydrochloride (1:2)

7-methyl-3,7,11-triazaspiro[5.6]dodecan-12-one dihydrochloride

CAS: 2095192-17-7

Formula: C₁₀H₂₁Cl₂N₃O

Purity: 95.0%

Molecular weight: 270.2

Ref: 10-F541620