CAS 2095410-64-1

Pyridine, 5-fluoro-2-[5-(4-piperidinylmethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:2)

Description:

Pyridine, 5-fluoro-2-[5-(4-piperidinylmethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyridine ring and an oxadiazole moiety. The presence of a fluorine atom at the 5-position of the pyridine ring enhances its electronic properties, potentially influencing its reactivity and biological activity. The compound also features a piperidine group, which is known for its role in various pharmacological applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in biological and chemical applications. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions and effects would depend on its molecular structure and the functional groups present, which can influence its binding affinity and activity in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₃H₁₅FN₄O·2ClH

InChI: InChI=1S/C13H15FN4O.2ClH/c14-10-1-2-11(16-8-10)13-17-12(19-18-13)7-9-3-5-15-6-4-9;;/h1-2,8-9,15H,3-7H2;2*1H

InChI key: InChIKey=XSNOQCYBHPTJTG-UHFFFAOYSA-N

SMILES: C(C1=NC(=NO1)C2=CC=C(F)C=N2)C3CCNCC3.Cl

Synonyms:

• Pyridine, 5-fluoro-2-[5-(4-piperidinylmethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:2)