CAS 2095410-83-4

1H-Pyrazole, 3-(bromomethyl)-1-methyl-, hydrobromide (1:1)

Description:

1H-Pyrazole, 3-(bromomethyl)-1-methyl-, hydrobromide (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a bromomethyl group at the 3-position and a methyl group at the 1-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. As a hydrobromide salt, it is typically encountered in a crystalline form, which enhances its stability and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other functional groups. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, this compound represents a versatile building block in the synthesis of more complex molecules.

Formula: C₅H₇BrN₂·BrH

InChI: InChI=1S/C5H7BrN2.BrH/c1-8-3-2-5(4-6)7-8;/h2-3H,4H2,1H3;1H

InChI key: InChIKey=JFBJUZRSFHTJKP-UHFFFAOYSA-N

SMILES: C(Br)C1=NN(C)C=C1.Br

Synonyms:

• 1H-Pyrazole, 3-(bromomethyl)-1-methyl-, hydrobromide (1:1)

3-(Bromomethyl)-1-methyl-1H-pyrazole hydrobromide

CAS: 2095410-83-4

Versatile small molecule scaffold

Formula: C₅H₈Br₂N₂

Purity: Min. 95%

Molecular weight: 255.94 g/mol

Ref: 3D-VID41083