CAS 209592-66-5
:2-(2,4-difluorophenyl)thiophene
Description:
2-(2,4-Difluorophenyl)thiophene is an organic compound characterized by its unique structure, which includes a thiophene ring and a difluorophenyl substituent. The thiophene moiety contributes to its aromatic properties and potential applications in organic electronics, such as organic semiconductors and photovoltaic materials. The presence of two fluorine atoms on the phenyl ring enhances the compound's electron-withdrawing characteristics, which can influence its reactivity and stability. This substitution pattern can also affect the compound's solubility and intermolecular interactions, making it of interest in various chemical and material science applications. Additionally, the compound's molecular structure may exhibit specific optical and electronic properties, making it suitable for research in fields like organic synthesis and materials chemistry. As with many fluorinated compounds, it may also exhibit unique environmental and biological behaviors, necessitating careful handling and assessment in practical applications. Overall, 2-(2,4-difluorophenyl)thiophene represents a versatile building block in the development of advanced organic materials.
Formula:C10H6F2S
InChI:InChI=1/C10H6F2S/c11-7-3-4-8(9(12)6-7)10-2-1-5-13-10/h1-6H
SMILES:c1cc(c2ccc(cc2F)F)sc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
