CymitQuimica logo

CAS 2096329-81-4

:

B-[4-[(Propylamino)sulfonyl]-2-(trifluoromethyl)phenyl]boronic acid

Description:
B-[4-[(Propylamino)sulfonyl]-2-(trifluoromethyl)phenyl]boronic acid is a boronic acid derivative characterized by its unique functional groups, which include a sulfonamide and a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the boronic acid and sulfonamide functionalities. The trifluoromethyl group contributes to its lipophilicity and can enhance biological activity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including drug development and organic synthesis. The presence of the propylamino group suggests potential interactions with biological targets, which may be relevant in medicinal chemistry. Additionally, the compound's structure may influence its reactivity and stability under different conditions, such as pH and temperature. Overall, this compound's unique combination of functional groups positions it as a potentially useful agent in pharmaceutical and chemical research.
Formula:C10H13BF3NO4S
InChI:InChI=1S/C10H13BF3NO4S/c1-2-5-15-20(18,19)7-3-4-9(11(16)17)8(6-7)10(12,13)14/h3-4,6,15-17H,2,5H2,1H3
InChI key:InChIKey=ASODGCPJAVWBFD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(B(O)O)C=CC(S(NCCC)(=O)=O)=C1
Synonyms:
  • Boronic acid, B-[4-[(propylamino)sulfonyl]-2-(trifluoromethyl)phenyl]-
  • B-[4-[(Propylamino)sulfonyl]-2-(trifluoromethyl)phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.