
CAS 2096331-63-2
:3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Description:
3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is an organic compound characterized by its complex structure, which includes a pyridine ring, a bromine atom, and a boron-containing dioxaborolane moiety. The presence of the bromine atom introduces electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The dioxaborolane group enhances the compound's stability and solubility in organic solvents, while also serving as a useful functional group in synthetic chemistry, particularly in cross-coupling reactions. The compound's amine functionality contributes to its basicity and potential reactivity with acids or electrophiles. Overall, this substance is of interest in medicinal chemistry and materials science due to its unique structural features and reactivity, which may facilitate the development of new pharmaceuticals or advanced materials. Its specific applications would depend on further studies and evaluations of its chemical behavior and biological activity.
Formula:C11H16BBrN2O2
InChI:InChI=1S/C11H16BBrN2O2/c1-10(2)11(3,4)17-12(16-10)7-5-8(13)9(14)15-6-7/h5-6H,1-4H3,(H2,14,15)
InChI key:InChIKey=QYUWTRUUTANJOK-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(Br)C(N)=NC2
Synonyms:- 2-Pyridinamine, 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-3-bromo-pyridine-5-boronicacidpinacolester
CAS:Formula:C11H16Bbrn2O2Color and Shape:SolidMolecular weight:298.9719 G/Mol

