CAS 2096335-60-1

B-[3-Chloro-4-[[(2-methylpropyl)amino]carbonyl]phenyl]boronic acid

Description:

B-[3-Chloro-4-[[(2-methylpropyl)amino]carbonyl]phenyl]boronic acid is a boronic acid derivative characterized by its boron atom bonded to a phenyl group that contains a chloro substituent and an amide functional group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the chloro group and the branched alkyl amine enhances its reactivity and solubility in organic solvents. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The specific structure of this compound suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of the amine and carbonyl functionalities. Overall, this compound's unique structural features contribute to its utility in chemical synthesis and potential therapeutic applications.

Formula: C₁₁H₁₅BClNO₃

InChI: InChI=1S/C11H15BClNO3/c1-7(2)6-14-11(15)9-4-3-8(12(16)17)5-10(9)13/h3-5,7,16-17H,6H2,1-2H3,(H,14,15)

InChI key: InChIKey=FQGJLHOYSUCWJU-UHFFFAOYSA-N

SMILES: C(NCC(C)C)(=O)C1=C(Cl)C=C(B(O)O)C=C1

Synonyms:

• B-[3-Chloro-4-[[(2-methylpropyl)amino]carbonyl]phenyl]boronic acid
• Boronic acid, B-[3-chloro-4-[[(2-methylpropyl)amino]carbonyl]phenyl]-

Boronic acid, B-[3-chloro-4-[[(2-methylpropyl)amino]carbonyl]phenyl]-

CAS: 2096335-60-1

Formula: C₁₁H₁₅BClNO₃

Purity: 95%

Molecular weight: 255.5057

Ref: IN-DA01P857

3-Chloro-4-(isobutylcarbamoyl)benzeneboronic acid

CAS: 2096335-60-1

Purity: ≥95%

Molecular weight: 255.5099945

Ref: 10-F627338