CAS 2096337-30-1: B-(3-Methoxy-5-isoquinolinyl)boronic acid

Description:B-(3-Methoxy-5-isoquinolinyl)boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that contains an isoquinoline moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methoxy group enhances its solubility and reactivity, while the isoquinoline structure may contribute to its biological activity. Boronic acids are known for their role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, this compound may exhibit potential as a ligand in coordination chemistry or as a building block in the synthesis of more complex organic molecules. Its unique structural features suggest that it could have applications in drug development or materials science, particularly in the design of compounds with specific electronic or optical properties.

Formula:C₁₀H₁₀BNO₃

InChI:InChI=1S/C10H10BNO3/c1-15-10-5-8-7(6-12-10)3-2-4-9(8)11(13)14/h2-6,13-14H,1H3

InChI key:InChIKey=VTDNRNDXZFEULW-UHFFFAOYSA-N

SMILES:OB(O)C1=CC=CC2=CN=C(OC)C=C21

Synonyms:
Boronic acid, B-(3-methoxy-5-isoquinolinyl)-
B-(3-Methoxy-5-isoquinolinyl)boronic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Methoxyisoquinoline-5-boronic acid REF: IN-DA01FL51CAS: 2096337-30-1	- - -	To inquire	Mon 21 Apr 25
3-Methoxyisoquinoline-5-boronic acid REF: 54-OR300144CAS: 2096337-30-1	- - -	To inquire	Mon 21 Apr 25
3-Methoxyisoquinolin-5-ylboronic acid REF: FT-M13497CAS: 2096337-30-1	>95%	To inquire	Mon 21 Apr 25
3-Methoxyisoquinolin-5-ylboronic acid REF: 10-F623682CAS: 2096337-30-1	97%	- - -	Discontinued product
3-Methoxyisoquinoline-5-boronic acid REF: 3D-WID33730CAS: 2096337-30-1	Min. 95%	- - -	Discontinued product