
CAS 2096338-36-0
:1-chloroisoquinolin-5-yl-5-boronic acid
Description:
1-Chloroisoquinolin-5-yl-5-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to an isoquinoline ring system. The compound features a chlorine substituent at the 1-position of the isoquinoline, which contributes to its reactivity and potential applications in organic synthesis. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in various chemical reactions, including Suzuki coupling, which is widely used in the formation of carbon-carbon bonds. The presence of the boronic acid group also imparts properties such as water solubility and the ability to participate in further functionalization. This compound may be utilized in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence biological activity. Additionally, its unique combination of functional groups allows for diverse applications in materials science and catalysis. Overall, 1-chloroisoquinolin-5-yl-5-boronic acid represents a versatile building block in synthetic organic chemistry.
Formula:C9H7BClNO2
Synonyms:- 1-chloroisoquinolin-5-yl-5-boronic acid
- Boronic acid, B-(1-chloro-5-isoquinolinyl)-
- (1-chloroisoquinolin-5-yl)boronic acid
- 1-Chloroisoquinolin-5-boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Chloroisoquinoline-5-boronic acid
CAS:1-Chloroisoquinoline-5-boronic acidPurity:≥95%Color and Shape:SolidMolecular weight:207.42g/mol


