CAS 2096339-88-5

B-[3,5-Difluoro-2-methyl-4-(1-methylethoxy)phenyl]boronic acid

Description:

B-[3,5-Difluoro-2-methyl-4-(1-methylethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with two fluorine atoms and a methyl group, enhancing its lipophilicity and potentially influencing its reactivity and biological activity. The presence of the 1-methylethoxy group contributes to its steric bulk, which can affect its interactions in chemical reactions, particularly in cross-coupling reactions commonly used in organic synthesis. Boronic acids are often utilized in medicinal chemistry and materials science due to their ability to participate in Suzuki-Miyaura coupling reactions, making this compound potentially valuable in the synthesis of complex organic molecules. Additionally, the fluorine substituents may impart unique electronic properties, influencing the compound's behavior in various chemical environments. Overall, this compound exemplifies the diverse applications of boronic acids in modern chemistry.

Formula: C₁₀H₁₃BF₂O₃

InChI: InChI=1S/C10H13BF2O3/c1-5(2)16-10-8(12)4-7(11(14)15)6(3)9(10)13/h4-5,14-15H,1-3H3

InChI key: InChIKey=UEQAIZUGLYZKNX-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(F)C(C)=C(B(O)O)C=C1F

Synonyms:

• B-[3,5-Difluoro-2-methyl-4-(1-methylethoxy)phenyl]boronic acid
• Boronic acid, B-[3,5-difluoro-2-methyl-4-(1-methylethoxy)phenyl]-