CAS 20965-30-4
:Ethanol, 2-(phenylthio)-, 1-acetate
Description:
Ethanol, 2-(phenylthio)-, 1-acetate, with the CAS number 20965-30-4, is an organic compound that belongs to the class of thioethers and esters. It features a phenylthio group, which contributes to its unique chemical properties, and an acetate functional group that indicates it is an ester derived from acetic acid. This compound is typically characterized by its moderate polarity due to the presence of both the thioether and ester functionalities, which can influence its solubility in various solvents. Ethanol, 2-(phenylthio)-, 1-acetate may exhibit interesting reactivity patterns, particularly in nucleophilic substitution reactions, owing to the presence of the acetate moiety. Additionally, it may have applications in organic synthesis, potentially serving as an intermediate in the preparation of more complex molecules. Its physical properties, such as boiling point and density, would depend on the specific molecular interactions and structural characteristics inherent to the compound. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H12O2S
InChI:InChI=1S/C10H12O2S/c1-9(11)12-7-8-13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3
InChI key:InChIKey=QHOGNNXLGUVURK-UHFFFAOYSA-N
SMILES:S(CCOC(C)=O)C1=CC=CC=C1
Synonyms:- 2-Acetoxyethyl phenyl sulfide
- β-Phenylthioethyl acetate
- Ethanol, 2-(phenylthio)-, 1-acetate
- Ethanol, 2-(phenylthio)-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
