CAS 2096994-91-9

1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[2-(trimethylsilyl)ethyl]phenyl]-

Description:

1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[2-(trimethylsilyl)ethyl]phenyl]- is a boron-containing organic compound characterized by its dioxaborolane ring structure, which contributes to its unique chemical properties. This compound features a boron atom bonded to oxygen in a cyclic arrangement, enhancing its reactivity and potential applications in organic synthesis, particularly in the formation of boron-containing intermediates. The presence of bulky tetramethyl groups and a trimethylsilyl substituent increases steric hindrance, which can influence its reactivity and solubility in various solvents. Additionally, the phenyl group provides aromatic stability and can participate in further chemical reactions. The compound's structure suggests potential utility in medicinal chemistry and materials science, particularly in the development of boron-based catalysts or reagents. Its CAS number, 2096994-91-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the diverse chemistry of boron compounds and their applications in synthetic organic chemistry.

Formula: C₁₇H₂₉BO₂Si

InChI: InChI=1S/C17H29BO2Si/c1-16(2)17(3,4)20-18(19-16)15-10-8-14(9-11-15)12-13-21(5,6)7/h8-11H,12-13H2,1-7H3

InChI key: InChIKey=GQZILDONIWCXMI-UHFFFAOYSA-N

SMILES: CC1(C)OB(OC1(C)C)C2=CC=C(CC[Si](C)(C)C)C=C2

Synonyms:

• 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[2-(trimethylsilyl)ethyl]phenyl]-
• 4,4,5,5-Tetramethyl-2-[4-[2-(trimethylsilyl)ethyl]phenyl]-1,3,2-dioxaborolane
• trimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenethyl)silane