
CAS 2097068-79-4
:5,8-Diazaspiro[3.5]nonane-5-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1)
Description:
5,8-Diazaspiro[3.5]nonane-5-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which includes a bicyclic framework containing nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride salt form indicates that the compound is protonated, which can improve its solubility in aqueous environments, making it more suitable for pharmaceutical applications. The presence of nitrogen atoms in the structure suggests potential interactions with biological targets, such as receptors or enzymes, which may be relevant in medicinal chemistry. Additionally, the spirocyclic nature of the compound may confer unique conformational properties, impacting its reactivity and interaction with other molecules. Overall, this compound's structural features suggest it could be of interest in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C12H22N2O2·ClH
InChI:InChI=1S/C12H22N2O2.ClH/c1-11(2,3)16-10(15)14-8-7-13-9-12(14)5-4-6-12;/h13H,4-9H2,1-3H3;1H
InChI key:InChIKey=ATDIXLVSEVFFMU-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2(CCC2)CNCC1.Cl
Synonyms:- 5,8-Diazaspiro[3.5]nonane-5-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,8-Diaza-spiro[3.5]nonane-5-carboxylicacidtert-butylesterhydrochloride
CAS:Formula:C12H23ClN2O2Molecular weight:262.7762
