CymitQuimica logo

CAS 2097073-13-5

:

Benzenemethanamine, α-(2,2,2-trifluoroethyl)-, hydrochloride (1:1), (αR)-

Description:
Benzenemethanamine, α-(2,2,2-trifluoroethyl)-, hydrochloride (1:1), (αR)-, is a chemical compound characterized by its amine functional group and a trifluoroethyl substituent, which significantly influences its physical and chemical properties. The presence of the trifluoroethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various formulations. The compound's stereochemistry, indicated by the (αR)- designation, suggests specific spatial arrangements of its atoms, which can impact its interaction with biological targets. This compound may exhibit properties such as basicity due to the amine group, and its hydrochloride form can stabilize the molecule in solution. Overall, its unique structure and properties make it a subject of interest in medicinal chemistry and related fields.
Formula:C9H10F3N·ClH
InChI:InChI=1S/C9H10F3N.ClH/c10-9(11,12)6-8(13)7-4-2-1-3-5-7;/h1-5,8H,6,13H2;1H/t8-;/m1./s1
InChI key:InChIKey=KRXZIGGEBOQRKO-DDWIOCJRSA-N
SMILES:[C@H](CC(F)(F)F)(N)C1=CC=CC=C1.Cl
Synonyms:
  • Benzenemethanamine, α-(2,2,2-trifluoroethyl)-, hydrochloride (1:1), (αR)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.