CAS 20972-36-5
:trans-3-(4-methylbenzoyl)acrylic acid
Description:
Trans-3-(4-methylbenzoyl)acrylic acid, with the CAS number 20972-36-5, is an organic compound characterized by its unique structural features. It contains an acrylic acid moiety, which is a derivative of prop-2-enoic acid, and a 4-methylbenzoyl group, contributing to its aromatic characteristics. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of both the carboxylic acid functional group and the carbon-carbon double bond in its structure allows for reactivity in polymerization and other chemical reactions. Additionally, the methyl group on the aromatic ring can influence its solubility and reactivity, making it a subject of interest in synthetic organic chemistry. Its trans configuration is significant, as it affects the compound's physical properties and reactivity compared to its cis counterpart. Overall, trans-3-(4-methylbenzoyl)acrylic acid is a versatile compound with notable chemical properties.
Formula:C11H10O3
InChI:InChI=1/C11H10O3/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+
Synonyms:- 3-(4-Methylbenzoyl)acrylic acid
- (2E)-4-(4-methylphenyl)-4-oxobut-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(4-Methylbenzoyl)acrylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H10O3Purity:98%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:190.202-Butenoic acid, 4-(4-methylphenyl)-4-oxo-, (2E)-
CAS:Formula:C11H10O3Purity:95%Color and Shape:SolidMolecular weight:190.19533-(4-Methylbenzoyl)acrylic acid
CAS:3-(4-Methylbenzoyl)acrylic acidPurity:95%+Molecular weight:190.20g/mol3-(4-Methylbenzoyl)acrylic acid
CAS:Formula:C11H10O3Purity:98.0%Color and Shape:SolidMolecular weight:190.198trans-3-(4-Methylbenzoyl)acrylic acid
CAS:The compound trans-3-(4-methylbenzoyl)acrylic acid is a potent and selective inhibitor of serine/threonine protein kinase. It has been shown to inhibit the proliferation of eosinophils in vitro, as well as to suppress the release of leukotrienes from human mast cells. The mechanism of action is by inhibiting phosphatidylcholine-specific phospholipase C, which leads to the inhibition of protein kinase C. This inhibition prevents the phosphorylation of various proteins, including cytoskeletal proteins that are required for cell division.
Formula:C11H10O3Purity:Min. 95%Molecular weight:190.2 g/molRef: 3D-FM54337
Discontinued product





