CAS 20979-50-4
:7-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
Description:
7-Methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one, with the CAS number 20979-50-4, is a synthetic organic compound belonging to the flavonoid class, specifically a type of chromone. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at the 7-position with a methoxy group and at the 2-position with a 4-methoxyphenyl group. The presence of these methoxy groups enhances its solubility and may influence its biological activity. Typically, compounds of this nature exhibit a range of pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer activities. The structural modifications contribute to its ability to interact with various biological targets, making it of interest in medicinal chemistry and drug development. Additionally, its stability and reactivity can be influenced by the methoxy substituents, which may affect its behavior in different chemical environments. Overall, 7-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one represents a compound with significant potential for further research in therapeutic applications.
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-19-12-5-3-11(4-6-12)16-10-15(18)14-8-7-13(20-2)9-17(14)21-16/h3-10H,1-2H3
SMILES:COc1ccc(cc1)c1cc(=O)c2ccc(cc2o1)OC
Synonyms:- 20979-50-4
- 4H-1-benzopyran-4-one, 7-methoxy-2-(4-methoxyphenyl)-
- 7-Methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
7,4'-Dimethoxyflavone
CAS:<p>7,4'-Dimethoxyflavone is a naturally occurring flavonoid derivative, which is found predominantly in certain plants, particularly within the citrus family. This compound is characterized by the presence of two methoxy groups attached to its flavone backbone. It functions by interacting with various biological pathways, including those involved in antioxidant and anti-inflammatory responses. Its molecular structure allows it to modulate enzyme activities and receptor interactions, although the exact mechanisms are still under study.</p>Formula:C17H14O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:282.29 g/mol
