CAS 2097938-74-2: Benzamide, 4-[2-[[[3,4-bis(phosphonooxy)phenyl]methyl]amino]-2-oxoethoxy]-N-(4-phenoxyphenyl)-

Description:Benzamide, 4-[2-[[[3,4-bis(phosphonooxy)phenyl]methyl]amino]-2-oxoethoxy]-N-(4-phenoxyphenyl)-, identified by CAS number 2097938-74-2, is a complex organic compound characterized by its benzamide structure, which includes a phenoxy group and a phosphonooxy substituent. This compound features a central benzamide moiety, which is known for its ability to engage in hydrogen bonding and its role in various biological activities. The presence of phosphono groups suggests potential applications in medicinal chemistry, particularly in the development of phosphonate-based drugs or as a biochemical probe. The ethoxy and amino functionalities enhance its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the compound's structural complexity may contribute to unique pharmacological properties, potentially influencing enzyme interactions or cellular pathways. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in both synthetic and medicinal chemistry.

Formula:C₂₈H₂₆N₂O₁₂P₂

InChI:InChI=1S/C28H26N2O12P2/c31-27(29-17-19-6-15-25(41-43(33,34)35)26(16-19)42-44(36,37)38)18-39-22-11-7-20(8-12-22)28(32)30-21-9-13-24(14-10-21)40-23-4-2-1-3-5-23/h1-16H,17-18H2,(H,29,31)(H,30,32)(H2,33,34,35)(H2,36,37,38)

InChI key:InChIKey=LJGIDZSIOSYQMR-UHFFFAOYSA-N

SMILES:O=C(NC1=CC=C(OC=2C=CC=CC2)C=C1)C3=CC=C(OCC(=O)NCC4=CC=C(OP(=O)(O)O)C(OP(=O)(O)O)=C4)C=C3

Synonyms:
Benzamide, 4-[2-[[[3,4-bis(phosphonooxy)phenyl]methyl]amino]-2-oxoethoxy]-N-(4-phenoxyphenyl)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Stafib-2 REF: 54-BUP03108CAS: 2097938-74-2	≥98%	1,479.00 €~2,727.00 €	Tue 06 May 25
Stafib-2 REF: 3D-XID93874CAS: 2097938-74-2	Min. 95%	To inquire	Mon 16 Jun 25
Stafib-2 REF: TM-T9646CAS: 2097938-74-2	98.97%	208.00 €~2,015.00 €	Mon 07 Jul 25