
CAS 2097938-74-2
:Benzamide, 4-[2-[[[3,4-bis(phosphonooxy)phenyl]methyl]amino]-2-oxoethoxy]-N-(4-phenoxyphenyl)-
Description:
Benzamide, 4-[2-[[[3,4-bis(phosphonooxy)phenyl]methyl]amino]-2-oxoethoxy]-N-(4-phenoxyphenyl)-, identified by CAS number 2097938-74-2, is a complex organic compound characterized by its benzamide structure, which includes a phenoxy group and a phosphonooxy substituent. This compound features a central benzamide moiety, which is known for its ability to engage in hydrogen bonding and its role in various biological activities. The presence of phosphono groups suggests potential applications in medicinal chemistry, particularly in the development of phosphonate-based drugs or as a biochemical probe. The ethoxy and amino functionalities enhance its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the compound's structural complexity may contribute to unique pharmacological properties, potentially influencing enzyme interactions or cellular pathways. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C28H26N2O12P2
InChI:InChI=1S/C28H26N2O12P2/c31-27(29-17-19-6-15-25(41-43(33,34)35)26(16-19)42-44(36,37)38)18-39-22-11-7-20(8-12-22)28(32)30-21-9-13-24(14-10-21)40-23-4-2-1-3-5-23/h1-16H,17-18H2,(H,29,31)(H,30,32)(H2,33,34,35)(H2,36,37,38)
InChI key:InChIKey=LJGIDZSIOSYQMR-UHFFFAOYSA-N
SMILES:O(P(=O)(O)O)C1=C(OP(=O)(O)O)C=CC(CNC(COC2=CC=C(C(NC3=CC=C(OC4=CC=CC=C4)C=C3)=O)C=C2)=O)=C1
Synonyms:- Benzamide, 4-[2-[[[3,4-bis(phosphonooxy)phenyl]methyl]amino]-2-oxoethoxy]-N-(4-phenoxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Stafib-2
CAS:<p>Stafib-2 is an analog inhibitor that has shown potent anticancer activity in human cancer cell lines. It works by inhibiting kinases, which are enzymes that play a key role in regulating cell growth and division. Stafib-2 has been shown to induce apoptosis, or programmed cell death, in Chinese hamster ovary cells and human cancer cells. This drug also inhibits the activity of elastin kinase, a protein that is involved in tumor growth and metastasis. Stafib-2 has potential as a targeted therapy for cancer treatment due to its ability to selectively inhibit specific kinases involved in cancer progression. Its unique mechanism of action makes it a promising candidate for further development as an anticancer agent.</p>Formula:C28H26N2O12P2Purity:Min. 95%Molecular weight:644.5 g/molStafib-2
CAS:<p>Stafib-2 is a potent and selective inhibitor of the transcription factor STAT5b.Stafib-2 inhibits STAT5b and STAT5a with IC50 values of 82 nM and 1.7 μM,</p>Formula:C28H26N2O12P2Purity:98.48%Color and Shape:SolidMolecular weight:644.46


