CAS 20984-82-1

3-Pyrrolidinamine, N,N-diethyl-, hydrochloride (1:2)

Description:

3-Pyrrolidinamine, N,N-diethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features two ethyl groups attached to the nitrogen atom, contributing to its classification as a diethyl derivative. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may be of interest in medicinal chemistry for its potential biological activities, although specific pharmacological properties would require further investigation. Safety data should be consulted, as with any chemical substance, to ensure proper handling and usage.

Formula: C₈H₁₈N₂·2ClH

InChI: InChI=1S/C8H18N2.2ClH/c1-3-10(4-2)8-5-6-9-7-8;;/h8-9H,3-7H2,1-2H3;2*1H

InChI key: InChIKey=FZJHRPNWBMMLHL-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1CCNC1.Cl

Synonyms:

• 3-(Diethylamino)pyrrolidine
• 3-Pyrrolidinamine, N,N-diethyl-, hydrochloride (1:2)
• Pyrrolidine, 3-(diethylamino)-, dihydrochloride

N,N-Diethyl-3-pyrrolidinamine Dihydrochloride

Controlled Product

CAS: 20984-82-1

Applications N,N-Diethyl-3-pyrrolidinamine Dihydrochloride (cas# 20984-82-1) is a useful research chemical.

Formula: C₈H₁₈N₂•2(HCl)

Color and Shape: Neat

Molecular weight: 178.12368

Ref: TR-D496248