CymitQuimica logo

CAS 209848-48-6

:

3-Pyridazinesulfonyl fluoride, 6-chloro-

Description:
3-Pyridazinesulfonyl fluoride, 6-chloro- is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a sulfonyl fluoride group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The chloro substituent at the 6-position of the pyridazine ring can influence the compound's biological activity and reactivity. This compound is typically handled with care due to the potential hazards associated with sulfonyl fluorides, which can be toxic and reactive. It is important to note that safety data sheets should be consulted for specific handling and storage guidelines. Overall, 3-Pyridazinesulfonyl fluoride, 6-chloro- is notable for its unique structural features and potential applications in various chemical processes.
Formula:C4H2ClFN2O2S
InChI:InChI=1S/C4H2ClFN2O2S/c5-3-1-2-4(8-7-3)11(6,9)10/h1-2H
InChI key:KQCBZJQYJGOUOC-UHFFFAOYSA-N
SMILES:C1=CC(=NN=C1S(=O)(=O)F)Cl
Found 0 products.