CAS 20986-40-7
:Ethyl 5-bromonicotinate
Description:
Ethyl 5-bromonicotinate is an organic compound that belongs to the class of nicotinic acid derivatives. It features a bromine atom substituted at the 5-position of the pyridine ring, along with an ethyl ester functional group. This compound is typically characterized by its molecular formula, which reflects the presence of carbon, hydrogen, nitrogen, and bromine atoms. Ethyl 5-bromonicotinate is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the bromine atom enhances its reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, this compound may exhibit biological activity, which can be explored in medicinal chemistry. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, ethyl 5-bromonicotinate serves as an important building block in synthetic organic chemistry.
Formula:C8H8BrNO2
InChI:InChI=1/C8H8BrNO2/c1-2-12-8(11)6-3-7(9)5-10-4-6/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cc(cnc1)Br
Synonyms:- 5-Bromonicotinic acid ethyl ester
- Ethyl 5-bromopyridine-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl 5-bromonicotinate, 98%
CAS:Ethyl 5-bromonicotinate is used as a key starting material for the preparation of 5-bromonicotinic acid hydrazide via reaction with a hydrazine hydrate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information maFormula:C8H8BrNO2Purity:98%Color and Shape:White, PowderMolecular weight:230.063-Pyridinecarboxylic acid, 5-bromo-, ethyl ester
CAS:Formula:C8H8BrNO2Purity:98%Color and Shape:SolidMolecular weight:230.0586Ethyl 5-Bromonicotinate
CAS:Formula:C8H8BrNO2Purity:>98.0%(GC)Color and Shape:White to Brown to Dark purple powder to crystalMolecular weight:230.06Ethyl 5-bromonicotinate
CAS:Ethyl 5-bromonicotinateFormula:C8H8BrNO2Purity:98%Color and Shape: red/brown solidMolecular weight:230.06g/mol





