CymitQuimica logo

CAS 209901-86-0

:

4'-(4-Fluorophenyl)-2,2':6',2''-terpyridine

Description:
4'-(4-Fluorophenyl)-2,2':6',2''-terpyridine is an organic compound characterized by its unique structure, which consists of a terpyridine framework substituted with a fluorophenyl group. This compound features a central pyridine ring connected to two additional pyridine units, creating a tridentate ligand capable of coordinating with metal ions. The presence of the fluorine atom on the phenyl ring enhances its electronic properties, potentially influencing its reactivity and interaction with other molecules. This compound is of interest in various fields, including coordination chemistry, materials science, and organic electronics, due to its ability to form complexes with transition metals and its potential applications in sensors and catalysts. Additionally, the fluorine substitution can affect the solubility, stability, and photophysical properties of the compound, making it a subject of study in the development of novel materials. Overall, 4'-(4-Fluorophenyl)-2,2':6',2''-terpyridine exemplifies the intricate relationship between molecular structure and function in chemical compounds.
Formula:C21H14FN3
InChI:InChI=1/C21H14FN3/c22-17-9-7-15(8-10-17)16-13-20(18-5-1-3-11-23-18)25-21(14-16)19-6-2-4-12-24-19/h1-14H
InChI key:MYQQZCVIAQFISL-UHFFFAOYSA-N
SMILES:c1ccnc(c1)c1cc(cc(c2ccccn2)n1)c1ccc(cc1)F
Synonyms:
  • 2,2':6',2''-Terpyridine, 4'-(4-Fluorophenyl)-
  • 209901-86-0
  • 4'-(4-Fluorphenyl)-2,2':6',2''-terpyridin
  • 4'-(4-Fluorophényl)-2,2':6',2''-terpyridine
Found 5 products.