CAS 209977-51-5
:N-[(2R,3S,4R,5R)-2,4,5-trihydroxy-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]acetamide
Description:
The chemical substance N-[(2R,3S,4R,5R)-2,4,5-trihydroxy-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]acetamide, with CAS number 209977-51-5, is a complex organic compound characterized by its multiple hydroxyl groups and a unique tetrahydropyran structure. This compound features a series of stereocenters, which contribute to its specific three-dimensional configuration, influencing its biological activity and interactions. The presence of hydroxyl groups suggests that it may exhibit strong hydrogen bonding capabilities, potentially enhancing its solubility in polar solvents. Additionally, the acetamide functional group indicates that it may participate in various chemical reactions typical of amides, such as acylation or hydrolysis. This compound is likely to be of interest in pharmaceutical or biochemical research due to its structural complexity and potential biological properties, possibly serving as a lead compound in drug development or as a biochemical probe in studies of carbohydrate metabolism.
Formula:C14H25NO11
InChI:InChI=1/C14H25NO11/c1-4(17)15-7-10(20)9(19)6(25-13(7)23)3-24-14-12(22)11(21)8(18)5(2-16)26-14/h5-14,16,18-23H,2-3H2,1H3,(H,15,17)/t5?,6?,7-,8-,9-,10+,11-,12-,13+,14+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-galactopyranose
CAS:Formula:C14H25NO11Color and Shape:SolidMolecular weight:383.34842-Acetamido-2-deoxy-6-O-(β-D-galactopyranosyl)-D-galactopyranose
CAS:2-Acetamido-2-deoxy-6-O-(β-D-galactopyranosyl)-D-galactopyranosePurity:≥95%2-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-galactopyranose
CAS:Formula:C14H25NO11Molecular weight:383.352-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-galactopyranose
CAS:2-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-galactopyranose is a model organism that is used in the study of virus replication. It is a substrate for viral glycosylation and has been shown to be involved in mammalian cell growth. 2-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-galactopyranose is an iron oxide and it can be used as a contrast agent for magnetic resonance imaging (MRI) or computed tomography (CT). The gene product has not yet been identified, but it has been shown to be involved in fatty acid metabolism and cancer. This molecule also plays a role in the life cycle of some infectious diseases, such as influenza A virus.Formula:C14H25NO11Purity:Min. 95%Color and Shape:White PowderMolecular weight:383.35 g/mol2-Acetamido-2-deoxy-6-O-(β-D-galactopyranosyl)-D-galactopyranose
CAS:Controlled ProductApplications Occurs as part of a glycoprotein isolated from the cervical mucus of the Bonnet monkey.
References Hatcher, V.B., et al.: Biochemistry, 16, 1815 (1977)Formula:C14H25NO11Color and Shape:NeatMolecular weight:383.35





