CAS 209984-30-5

5-methyl-7H-benzo[d][3]benzazepin-6-one

Description:

5-Methyl-7H-benzo[d][3]benzazepin-6-one is a chemical compound characterized by its complex polycyclic structure, which includes a benzazepine framework. This compound features a methyl group at the 5-position and a ketone functional group at the 6-position, contributing to its unique chemical properties. The presence of multiple aromatic rings in its structure often imparts significant stability and hydrophobic characteristics, which can influence its solubility and reactivity. Compounds of this type may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The specific arrangement of atoms and functional groups can lead to diverse interactions with biological targets, potentially resulting in pharmacological effects. Additionally, the compound's molecular weight, melting point, and spectral properties (such as NMR and IR) would provide further insights into its characteristics and applications. Overall, 5-methyl-7H-benzo[d][3]benzazepin-6-one represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₅H₁₃NO

InChI: InChI=1/C15H13NO/c1-16-14-9-5-4-8-13(14)12-7-3-2-6-11(12)10-15(16)17/h2-9H,10H2,1H3

SMILES: CN1c2ccccc2c2ccccc2CC1=O

Synonyms:

• 5-Methyl-5,7-dihydro-6H-dibenzo[b,d]azepin-6-on
• 5-Methyl-5,7-dihydro-6H-dibenzo[b,d]azepin-6-one
• 6H-dibenz[b,d]azepin-6-one, 5,7-dihydro-5-methyl-

8-methyl-8-azatricyclo[9.4.0.0^{2,7}]pentadeca-1(15),2(7),3,5,11,13-hexaen-9-one

CAS: 209984-30-5

Formula: C₁₅H₁₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 223.2698

Ref: IN-DA002KIB

5-Methyl-5H-dibenzo[b,d]azepin-6(7H)-one

CAS: 209984-30-5

Purity: 95.0%

Molecular weight: 223.27499389648438

Ref: 10-F431749

5,7-Dihydro-5-methyl-6H-dibenz[b,d]azepin-6-one

Controlled Product

CAS: 209984-30-5

Applications An intermediate in the production of γ-secretase inhibitors.
References Fauq, A., et al.: Bioorg. Med. Chem. Lett., 17, 6392 (2007), Peters, J., et al.: Bioorg. Med. Chem. Lett., 17, 5918 (2007),

Formula: C₁₅H₁₃NO

Color and Shape: Neat

Molecular weight: 223.27

Ref: TR-D449335