CAS 209984-56-5: N~2~-[(3,5-difluorophenyl)acetyl]-N-[(7S)-5-methyl-6-oxo-6,7-dihydro-5H-dibenzo[b,d]azepin-7-yl]-L-alaninamide
Description:The chemical substance known as N~2~-[(3,5-difluorophenyl)acetyl]-N-[(7S)-5-methyl-6-oxo-6,7-dihydro-5H-dibenzo[b,d]azepin-7-yl]-L-alaninamide, with the CAS number 209984-56-5, is a complex organic compound characterized by its unique structural features. It contains a dibenzoazepine core, which contributes to its potential biological activity, particularly in pharmacological contexts. The presence of the difluorophenyl group suggests enhanced lipophilicity and may influence the compound's interaction with biological targets. Additionally, the L-alaninamide moiety indicates that it may exhibit properties related to amino acids, potentially affecting its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry, possibly as a candidate for drug development, given its structural complexity and the presence of functional groups that can participate in various chemical interactions. Its specific properties, such as solubility, stability, and biological activity, would require empirical investigation to fully characterize its behavior in different environments.
Formula:C26H23F2N3O3
InChI:InChI=1/C26H23F2N3O3/c1-15(29-23(32)13-16-11-17(27)14-18(28)12-16)25(33)30-24-21-9-4-3-7-19(21)20-8-5-6-10-22(20)31(2)26(24)34/h3-12,14-15,24H,13H2,1-2H3,(H,29,32)(H,30,33)/t15-,24-/m0/s1